ChemNet > CAS > 175205-01-3 2-[(6-메톡시-3-니트로-2-피리딜)티오]프로판산
175205-01-3 2-[(6-메톡시-3-니트로-2-피리딜)티오]프로판산
| 상품명칭 |
2-[(6-메톡시-3-니트로-2-피리딜)티오]프로판산 |
| 별명 |
2-[(6-메톡시-3-니트로피리딘-2-일)설파닐]프로판산 |
| 영문 이름 |
2-[(6-methoxy-3-nitro-2-pyridyl)thio]propanoic acid;2-[(6-methoxy-3-nitropyridin-2-yl)sulfanyl]propanoic acid |
| 분자식 |
C9H10N2O5S |
| 분자량 |
258.2511 |
| InChI |
InChI=1/C9H10N2O5S/c1-5(9(12)13)17-8-6(11(14)15)3-4-7(10-8)16-2/h3-5H,1-2H3,(H,12,13) |
| cas번호 |
175205-01-3 |
| 분자 구조 |
|
| 밀도 |
1.47g/cm3 |
| 녹는 점 |
196℃ |
| 비등점 |
434.5°C at 760 mmHg |
| 굴절 지수 |
1.605 |
| 인화점 |
216.6°C |
| 증기압 |
2.56E-08mmHg at 25°C |
| 위험성 표시 |
Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|